Two new coordination polymers,[Co(BYBA)2(4,4'-bpy)(H2O)2]·H2O (1) and [Zn(BYBA)2(4,4'-bpy)] (2) (4,4'-bpy=4,4'-bipyridine,BYBAH= 2-benzoylbenzoic acid),have been synthesized by hydrothermal co...Two new coordination polymers,[Co(BYBA)2(4,4'-bpy)(H2O)2]·H2O (1) and [Zn(BYBA)2(4,4'-bpy)] (2) (4,4'-bpy=4,4'-bipyridine,BYBAH= 2-benzoylbenzoic acid),have been synthesized by hydrothermal conditions and characterized by single-crystal X-ray diffraction,elemental analyses,IR spectra and fluorescence spectrum.Crystal data for 1:C38H32CoN2O9,Mr= 719.59,monoclinic,space group P2/c,a=22.981(2),b=11.4438(11),c=12.9327(12),β=94.642(1)°,V=3390.0(5)3,Z=4,Dc=1.410 g/cm3,F(000)=1492,R=0.0488 and wR=0.1201;and those for 2:C38H26ZnN2O6,Mr=672.00,triclinic,space group P1,a=8.7032(10),b=11.4882(13),c=16.872(2),α=107.146(1),β=99.055(1),γ=90.851(2)°,V=1588.5(3)3,Z= 2,Dc=1.405 g/cm3,F(000)=692,R=0.0409 and wR=0.0894.Complex 1 exhibits 1D polymeric chains which are linked into a 2D sheet by π···π interactions.Complex 2 is composed by 1D zigzag chains connected through C-H···π stacking interactions to generate a 2D layer.展开更多
A new cadmium(II) complex Cd(OBBA)2(2,2A-bipy)2 with 2-benzoylbenzoic acid(HOBBA) and 2,2-bipyridine(2,2A-bipy) as ligands has been synthesized. Crystal data for the complex are as follows: monoclinic, space group P21...A new cadmium(II) complex Cd(OBBA)2(2,2A-bipy)2 with 2-benzoylbenzoic acid(HOBBA) and 2,2-bipyridine(2,2A-bipy) as ligands has been synthesized. Crystal data for the complex are as follows: monoclinic, space group P21/c with a = 16.402(3), b = 10.4191(18), c = 23.395(4) A, β = 91.765(2)o, V = 3996.2(12) A3, Dc = 1.455 gAcm-3, Z = 4, μ(Mo Kα) = 0.603 mm-1, F(000) = 1784, the final R = 0.0218 and w R = 0.0558. In the electrode reaction, its electron transfer is quasi reversible and the electrode reaction corresponds to Cd(II)/Cd(0). Under 618 nm radiation, the title complex shows a strong fluorescent band at around 326 nm. In addition, in the range of 2~300 K, this complex displays diamagnetic property.展开更多
A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic...A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.展开更多
基金supported by the NNSFC (No. 20771023)the State 863 Program Project (No. 2007AA03z218)Analysis and Testing Foundation of Northeast Normal University
文摘Two new coordination polymers,[Co(BYBA)2(4,4'-bpy)(H2O)2]·H2O (1) and [Zn(BYBA)2(4,4'-bpy)] (2) (4,4'-bpy=4,4'-bipyridine,BYBAH= 2-benzoylbenzoic acid),have been synthesized by hydrothermal conditions and characterized by single-crystal X-ray diffraction,elemental analyses,IR spectra and fluorescence spectrum.Crystal data for 1:C38H32CoN2O9,Mr= 719.59,monoclinic,space group P2/c,a=22.981(2),b=11.4438(11),c=12.9327(12),β=94.642(1)°,V=3390.0(5)3,Z=4,Dc=1.410 g/cm3,F(000)=1492,R=0.0488 and wR=0.1201;and those for 2:C38H26ZnN2O6,Mr=672.00,triclinic,space group P1,a=8.7032(10),b=11.4882(13),c=16.872(2),α=107.146(1),β=99.055(1),γ=90.851(2)°,V=1588.5(3)3,Z= 2,Dc=1.405 g/cm3,F(000)=692,R=0.0409 and wR=0.0894.Complex 1 exhibits 1D polymeric chains which are linked into a 2D sheet by π···π interactions.Complex 2 is composed by 1D zigzag chains connected through C-H···π stacking interactions to generate a 2D layer.
基金Supported by the Scientific Research Fund of Hunan Provincial Education Department(No.11C0186)the Construct Program of the Key Discipline in Hunan Province
文摘A new cadmium(II) complex Cd(OBBA)2(2,2A-bipy)2 with 2-benzoylbenzoic acid(HOBBA) and 2,2-bipyridine(2,2A-bipy) as ligands has been synthesized. Crystal data for the complex are as follows: monoclinic, space group P21/c with a = 16.402(3), b = 10.4191(18), c = 23.395(4) A, β = 91.765(2)o, V = 3996.2(12) A3, Dc = 1.455 gAcm-3, Z = 4, μ(Mo Kα) = 0.603 mm-1, F(000) = 1784, the final R = 0.0218 and w R = 0.0558. In the electrode reaction, its electron transfer is quasi reversible and the electrode reaction corresponds to Cd(II)/Cd(0). Under 618 nm radiation, the title complex shows a strong fluorescent band at around 326 nm. In addition, in the range of 2~300 K, this complex displays diamagnetic property.
基金Supported by the Natural Science Foundation of Hunan Province (No. 11JJ9006)Key Project of Science and Technology Plan of Hunan Province (2012FJ2002)+1 种基金Science and Technology Plan of Hunan Province (2012GK3031, 2012WK3029)the Construct Program of Key Discipline in Hunan Province
文摘A new complex Cu2(o-C6H5COC6H5COO)4(C10H8N2)2(H2O)2 with 2-benzoylben- zoic acid and 2,2′-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Co, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) A, β = 100.8950(10)°, V = 6704.1(12) A3, Dc = 1.364 g/cm3, Z = 8,μ(MoKa) = 0.704 mml, F(000) = 2840, the final R= 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2′-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2′-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.